Products 1330236-21-9
CAS 1330236-21-9 appears in our catalog under these names: Phentermine-d5 Hydrochloride, >95% (HPLC), Phentermine-d5 HCl (phenyl-d5), 98 atom % D, min 98% Chemical Purity, Phentermine–d5 (hydrochloride) (CRM), Phentermine-d5 hydrochloride. Offered by: TRC, CDN, GLPBio, Biosynth. Available pack sizes: 50mg, 5mg, 0,01g, 0,005g, 1mg, 10mg, 25mg.
2-methyl-1-(2,3,4,5,6-pentadeuteriophenyl)propan-2-amine;hydrochloride (CAS 1330236-21-9) is a chemical compound with the molecular formula C10H16ClN and a molecular weight of 190.72 g/mol. IUPAC name: 2-methyl-1-(2,3,4,5,6-pentadeuteriophenyl)propan-2-amine;hydrochloride. InChIKey: NCAIGTHBQTXTLR-BQAHAFBHSA-N.
| Molecular formula | C10H16ClN |
|---|---|
| Molecular weight | 190.72 g/mol |
| IUPAC name | 2-methyl-1-(2,3,4,5,6-pentadeuteriophenyl)propan-2-amine;hydrochloride |
| InChIKey | NCAIGTHBQTXTLR-BQAHAFBHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CC(C)(C)N)[2H])[2H].Cl |
Computed by PubChem (NCBI)