CAS 1330260-89-3 appears in our catalog under these names: Hydroxy Tyrosol-d4, >95% (HPLC), Hydroxytyrosol–d4, Hydroxytyrosol-d4, 96.0%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 500μg, 2.5 mg, 500 μg.
4-(1,1,2,2-tetradeuterio-2-hydroxyethyl)benzene-1,2-diol (CAS 1330260-89-3) is a chemical compound with the molecular formula C8H10O3 and a molecular weight of 158.19 g/mol. IUPAC name: 4-(1,1,2,2-tetradeuterio-2-hydroxyethyl)benzene-1,2-diol. InChIKey: JUUBCHWRXWPFFH-KHORGVISSA-N.
| Molecular formula | C8H10O3 |
|---|---|
| Molecular weight | 158.19 g/mol |
| IUPAC name | 4-(1,1,2,2-tetradeuterio-2-hydroxyethyl)benzene-1,2-diol |
| InChIKey | JUUBCHWRXWPFFH-KHORGVISSA-N |
| SMILES | [2H]C([2H])(C1=CC(=C(C=C1)O)O)C([2H])([2H])O |
Computed by PubChem (NCBI)