CAS 294660-90-5 is the registry number for Hydroxy Tyrosol-d3. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 25mg, 50mg, 100mg.
3,4,6-trideuterio-5-(2-hydroxyethyl)benzene-1,2-diol (CAS 294660-90-5) is a chemical compound with the molecular formula C8H10O3 and a molecular weight of 157.18 g/mol. IUPAC name: 3,4,6-trideuterio-5-(2-hydroxyethyl)benzene-1,2-diol. InChIKey: JUUBCHWRXWPFFH-FYFKOAPZSA-N.
| Molecular formula | C8H10O3 |
|---|---|
| Molecular weight | 157.18 g/mol |
| IUPAC name | 3,4,6-trideuterio-5-(2-hydroxyethyl)benzene-1,2-diol |
| InChIKey | JUUBCHWRXWPFFH-FYFKOAPZSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CCO)[2H])O)O)[2H] |
Computed by PubChem (NCBI)