Products 294660-90-5

CAS 294660-90-5 is the registry number for Hydroxy Tyrosol-d3. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 25mg, 50mg, 100mg.

Structural formula: {0} (CAS {1})

3,4,6-trideuterio-5-(2-hydroxyethyl)benzene-1,2-diol (CAS 294660-90-5) is a chemical compound with the molecular formula C8H10O3 and a molecular weight of 157.18 g/mol. IUPAC name: 3,4,6-trideuterio-5-(2-hydroxyethyl)benzene-1,2-diol. InChIKey: JUUBCHWRXWPFFH-FYFKOAPZSA-N.

Identity
Molecular formulaC8H10O3
Molecular weight157.18 g/mol
IUPAC name3,4,6-trideuterio-5-(2-hydroxyethyl)benzene-1,2-diol
InChIKeyJUUBCHWRXWPFFH-FYFKOAPZSA-N
SMILES[2H]C1=C(C(=C(C(=C1CCO)[2H])O)O)[2H]

Computed by PubChem (NCBI)