CAS 1330265-54-7 appears in our catalog under these names: 2-Benzyloxy-3-nitro-benzoic Acid-13C6 Benzyl Ester, 2-Benzyloxy-3-nitro-benzoic Acid Benzyl Ester-13C6. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 25 mg.
Benzyl 3-nitro-2-phenylmethoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate (CAS 1330265-54-7) is a chemical compound with the molecular formula C21H17NO5 and a molecular weight of 369.32 g/mol. IUPAC name: benzyl 3-nitro-2-phenylmethoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate. InChIKey: PASQATSQCXYGQJ-VFPCLECSSA-N.
| Molecular formula | C21H17NO5 |
|---|---|
| Molecular weight | 369.32 g/mol |
| IUPAC name | benzyl 3-nitro-2-phenylmethoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate |
| InChIKey | PASQATSQCXYGQJ-VFPCLECSSA-N |
| SMILES | C1=CC=C(C=C1)CO[13C]2=[13C]([13CH]=[13CH][13CH]=[13C]2[N+](=O)[O-])C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)