Products 2137686-56-5
CAS 2137686-56-5 is the registry number for 3-(({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)methyl)furan-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,1g, 0,05g, 0,25g, 1g, 0,5g.
3-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]furan-2-carboxylic acid (CAS 2137686-56-5) is a chemical compound with the molecular formula C21H17NO5 and a molecular weight of 363.4 g/mol. IUPAC name: 3-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]furan-2-carboxylic acid. InChIKey: BAAOVPGNOVOIHZ-UHFFFAOYSA-N.
| Molecular formula | C21H17NO5 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 3-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]furan-2-carboxylic acid |
| InChIKey | BAAOVPGNOVOIHZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC4=C(OC=C4)C(=O)O |
Computed by PubChem (NCBI)