CAS 503469-51-0 appears in our catalog under these names: 5-({((9H-fluoren-9-ylmethoxy)carbonyl)amino}methyl)furan-2-carboxylic acid, 95%, 5-(({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)methyl)furan-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]furan-2-carboxylic acid (CAS 503469-51-0) is a chemical compound with the molecular formula C21H17NO5 and a molecular weight of 363.4 g/mol. IUPAC name: 5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]furan-2-carboxylic acid. InChIKey: KRRSDMPUICWCLM-UHFFFAOYSA-N.
| Molecular formula | C21H17NO5 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]furan-2-carboxylic acid |
| InChIKey | KRRSDMPUICWCLM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC4=CC=C(O4)C(=O)O |
Computed by PubChem (NCBI)