Products 1330267-50-9
CAS 1330267-50-9 is the registry number for Mexiletine-d6. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,1,1,2,3,3-hexadeuterio-3-(2,6-dimethylphenoxy)propan-2-amine (CAS 1330267-50-9) is a chemical compound with the molecular formula C11H17NO and a molecular weight of 185.30 g/mol. IUPAC name: 1,1,1,2,3,3-hexadeuterio-3-(2,6-dimethylphenoxy)propan-2-amine. InChIKey: VLPIATFUUWWMKC-DZMJLSHMSA-N.
| Molecular formula | C11H17NO |
|---|---|
| Molecular weight | 185.30 g/mol |
| IUPAC name | 1,1,1,2,3,3-hexadeuterio-3-(2,6-dimethylphenoxy)propan-2-amine |
| InChIKey | VLPIATFUUWWMKC-DZMJLSHMSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])OC1=C(C=CC=C1C)C)N |
Computed by PubChem (NCBI)