CAS 1330286-48-0 is the registry number for (S)-Acetamidomethyl-l-penicillamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(2S)-3-(acetamidomethylsulfanyl)-2-amino-3-methylbutanoic acid;hydrochloride (CAS 1330286-48-0) is a chemical compound with the molecular formula C8H17ClN2O3S and a molecular weight of 256.75 g/mol. IUPAC name: (2S)-3-(acetamidomethylsulfanyl)-2-amino-3-methylbutanoic acid;hydrochloride. InChIKey: HMNWKDNSRCKPAN-RGMNGODLSA-N.
| Molecular formula | C8H17ClN2O3S |
|---|---|
| Molecular weight | 256.75 g/mol |
| IUPAC name | (2S)-3-(acetamidomethylsulfanyl)-2-amino-3-methylbutanoic acid;hydrochloride |
| InChIKey | HMNWKDNSRCKPAN-RGMNGODLSA-N |
| SMILES | CC(=O)NCSC(C)(C)[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)