CAS 2504201-90-3 is the registry number for 1-Morpholin-4-ylmethyl-cyclopropanesulfonic acid amide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 500mg.
1-(morpholin-4-ylmethyl)cyclopropane-1-sulfonamide;hydrochloride (CAS 2504201-90-3) is a chemical compound with the molecular formula C8H17ClN2O3S and a molecular weight of 256.75 g/mol. IUPAC name: 1-(morpholin-4-ylmethyl)cyclopropane-1-sulfonamide;hydrochloride. InChIKey: YQKXPHRMVXECIE-UHFFFAOYSA-N.
| Molecular formula | C8H17ClN2O3S |
|---|---|
| Molecular weight | 256.75 g/mol |
| IUPAC name | 1-(morpholin-4-ylmethyl)cyclopropane-1-sulfonamide;hydrochloride |
| InChIKey | YQKXPHRMVXECIE-UHFFFAOYSA-N |
| SMILES | C1CC1(CN2CCOCC2)S(=O)(=O)N.Cl |
Computed by PubChem (NCBI)