CAS 2375271-24-0 is the registry number for Methyl 1-(imino(methyl)oxo-λ6-sulfanyl)piperidine-4-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 1-(methylsulfonimidoyl)piperidine-4-carboxylate;hydrochloride (CAS 2375271-24-0) is a chemical compound with the molecular formula C8H17ClN2O3S and a molecular weight of 256.75 g/mol. IUPAC name: methyl 1-(methylsulfonimidoyl)piperidine-4-carboxylate;hydrochloride. InChIKey: GMGOBHLMGNNZLZ-UHFFFAOYSA-N.
| Molecular formula | C8H17ClN2O3S |
|---|---|
| Molecular weight | 256.75 g/mol |
| IUPAC name | methyl 1-(methylsulfonimidoyl)piperidine-4-carboxylate;hydrochloride |
| InChIKey | GMGOBHLMGNNZLZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCN(CC1)S(=N)(=O)C.Cl |
Computed by PubChem (NCBI)