CAS 1330750-46-3 is the registry number for 6,7-Difluoro-1-isopropylbenzoimidazole, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
6,7-difluoro-1-propan-2-ylbenzimidazole (CAS 1330750-46-3) is a chemical compound with the molecular formula C10H10F2N2 and a molecular weight of 196.20 g/mol. IUPAC name: 6,7-difluoro-1-propan-2-ylbenzimidazole. InChIKey: DHZCGWZHWVIVAL-UHFFFAOYSA-N.
| Molecular formula | C10H10F2N2 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 6,7-difluoro-1-propan-2-ylbenzimidazole |
| InChIKey | DHZCGWZHWVIVAL-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=NC2=C1C(=C(C=C2)F)F |
Computed by PubChem (NCBI)