CAS 1381944-71-3 appears in our catalog under these names: 1-Ethyl-6,7-difluoro-2-methyl-1,3-benzodiazole, 98%, 1-Ethyl-6,7-difluoro-2-methyl-1,3-benzodiazole, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 25g.
1-ethyl-6,7-difluoro-2-methylbenzimidazole (CAS 1381944-71-3) is a chemical compound with the molecular formula C10H10F2N2 and a molecular weight of 196.20 g/mol. IUPAC name: 1-ethyl-6,7-difluoro-2-methylbenzimidazole. InChIKey: SKDUYSLVKIQPBU-UHFFFAOYSA-N.
| Molecular formula | C10H10F2N2 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 1-ethyl-6,7-difluoro-2-methylbenzimidazole |
| InChIKey | SKDUYSLVKIQPBU-UHFFFAOYSA-N |
| SMILES | CCN1C(=NC2=C1C(=C(C=C2)F)F)C |
Computed by PubChem (NCBI)