CAS 2305614-37-1 is the registry number for 2-(3,4-Difluorophenyl)-5-methyl-4,5-dihydro-1H-imidazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,4-difluorophenyl)-5-methyl-4,5-dihydro-1H-imidazole (CAS 2305614-37-1) is a chemical compound with the molecular formula C10H10F2N2 and a molecular weight of 196.20 g/mol. IUPAC name: 2-(3,4-difluorophenyl)-5-methyl-4,5-dihydro-1H-imidazole. InChIKey: MRGIKSOVTDWGFQ-UHFFFAOYSA-N.
| Molecular formula | C10H10F2N2 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)-5-methyl-4,5-dihydro-1H-imidazole |
| InChIKey | MRGIKSOVTDWGFQ-UHFFFAOYSA-N |
| SMILES | CC1CN=C(N1)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)