CAS 1331185-69-3 is the registry number for 3-Bromo-N-(2-hydroxy-1,1-dimethylethyl)-2-methyl-benzamide. Offered by: TRC. Available pack sizes: 100mg, 1g.
3-bromo-N-(1-hydroxy-2-methylpropan-2-yl)-2-methylbenzamide (CAS 1331185-69-3) is a chemical compound with the molecular formula C12H16BrNO2 and a molecular weight of 286.16 g/mol. IUPAC name: 3-bromo-N-(1-hydroxy-2-methylpropan-2-yl)-2-methylbenzamide. InChIKey: MQFUUIWCCMFTPY-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO2 |
|---|---|
| Molecular weight | 286.16 g/mol |
| IUPAC name | 3-bromo-N-(1-hydroxy-2-methylpropan-2-yl)-2-methylbenzamide |
| InChIKey | MQFUUIWCCMFTPY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1Br)C(=O)NC(C)(C)CO |
Computed by PubChem (NCBI)