CAS 133145-15-0 appears in our catalog under these names: 6-Chloropyridine-2-sulfonic acid, 95%, 6-Chloropyridine-2-sulfonic acid/ 90%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 100mg.
6-chloropyridine-2-sulfonic acid (CAS 133145-15-0) is a chemical compound with the molecular formula C5H4ClNO3S and a molecular weight of 193.61 g/mol. IUPAC name: 6-chloropyridine-2-sulfonic acid. InChIKey: FVCRHRGJNJCJQS-UHFFFAOYSA-N.
| Molecular formula | C5H4ClNO3S |
|---|---|
| Molecular weight | 193.61 g/mol |
| IUPAC name | 6-chloropyridine-2-sulfonic acid |
| InChIKey | FVCRHRGJNJCJQS-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Cl)S(=O)(=O)O |
Computed by PubChem (NCBI)