CAS 1780995-58-5 is the registry number for 2-Hydroxypyridine-3-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-oxo-1H-pyridine-3-sulfonyl chloride (CAS 1780995-58-5) is a chemical compound with the molecular formula C5H4ClNO3S and a molecular weight of 193.61 g/mol. IUPAC name: 2-oxo-1H-pyridine-3-sulfonyl chloride. InChIKey: QOCXBOFYGWMULQ-UHFFFAOYSA-N.
| Molecular formula | C5H4ClNO3S |
|---|---|
| Molecular weight | 193.61 g/mol |
| IUPAC name | 2-oxo-1H-pyridine-3-sulfonyl chloride |
| InChIKey | QOCXBOFYGWMULQ-UHFFFAOYSA-N |
| SMILES | C1=CNC(=O)C(=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)