Products 1357566-60-9

CAS 1357566-60-9 appears in our catalog under these names: 6-Oxo-1,6-dihydropyridine-3-sulfonyl chloride, 95%, 6-Oxo-1,6-dihydropyridine-3-sulfonyl Chloride, 6-oxo-1,6-dihydropyridine-3-sulfonyl chloride, 97%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 100mg, 5g, 1g, 250mg, 500mg.

Structural formula: {0} (CAS {1})

6-oxo-1H-pyridine-3-sulfonyl chloride (CAS 1357566-60-9) is a chemical compound with the molecular formula C5H4ClNO3S and a molecular weight of 193.61 g/mol. IUPAC name: 6-oxo-1H-pyridine-3-sulfonyl chloride. InChIKey: VYWHYGVVFBUDLY-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4ClNO3S
Molecular weight193.61 g/mol
IUPAC name6-oxo-1H-pyridine-3-sulfonyl chloride
InChIKeyVYWHYGVVFBUDLY-UHFFFAOYSA-N
SMILESC1=CC(=O)NC=C1S(=O)(=O)Cl

Computed by PubChem (NCBI)