Products 133146-00-6
CAS 133146-00-6 appears in our catalog under these names: Yohimbine-d3, Yohimbine–d3, Yohimbine-d3, 99%, 99%, Yohimbine-d3, 99.36%. Offered by: Chemat Brand, GLPBio, Chemat, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 5 mg, 10 mg, 1 mg.
Trideuteriomethyl (1S,15R,18S,19R,20S)-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate (CAS 133146-00-6) is a chemical compound with the molecular formula C21H26N2O3 and a molecular weight of 357.5 g/mol. IUPAC name: trideuteriomethyl (1S,15R,18S,19R,20S)-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate. InChIKey: BLGXFZZNTVWLAY-DJOPYVKOSA-N.
| Molecular formula | C21H26N2O3 |
|---|---|
| Molecular weight | 357.5 g/mol |
| IUPAC name | trideuteriomethyl (1S,15R,18S,19R,20S)-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate |
| InChIKey | BLGXFZZNTVWLAY-DJOPYVKOSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)[C@H]1[C@H](CC[C@@H]2[C@@H]1C[C@H]3C4=C(CCN3C2)C5=CC=CC=C5N4)O |
Computed by PubChem (NCBI)
Synonyms:
Yohimbine-d3