Products 483-09-0
CAS 483-09-0 appears in our catalog under these names: Isorauhimbin, Isorauhimbine. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 5 mg, 1 mg.
Methyl (1R,15S,18S,19S,20S)-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate (CAS 483-09-0) is a chemical compound with the molecular formula C21H26N2O3 and a molecular weight of 354.4 g/mol. IUPAC name: methyl (1R,15S,18S,19S,20S)-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate. InChIKey: BLGXFZZNTVWLAY-RIEHRDFOSA-N.
| Molecular formula | C21H26N2O3 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | methyl (1R,15S,18S,19S,20S)-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate |
| InChIKey | BLGXFZZNTVWLAY-RIEHRDFOSA-N |
| SMILES | COC(=O)[C@@H]1[C@H](CC[C@H]2[C@@H]1C[C@@H]3C4=C(CCN3C2)C5=CC=CC=C5N4)O |
Computed by PubChem (NCBI)