CAS 133149-09-4 is the registry number for Methyl (2S)-2-bromo-2-((4S)-2,2-dimethyl-1,3-dioxolan-4-yl)acetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl (2S)-2-bromo-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate (CAS 133149-09-4) is a chemical compound with the molecular formula C8H13BrO4 and a molecular weight of 253.09 g/mol. IUPAC name: methyl (2S)-2-bromo-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate. InChIKey: BVSBOVWTJOHGIM-WDSKDSINSA-N.
| Molecular formula | C8H13BrO4 |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | methyl (2S)-2-bromo-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate |
| InChIKey | BVSBOVWTJOHGIM-WDSKDSINSA-N |
| SMILES | CC1(OC[C@H](O1)[C@@H](C(=O)OC)Br)C |
Computed by PubChem (NCBI)