Products 1331639-92-9

CAS 1331639-92-9 is the registry number for rac-11-Deoxy-8(12)-dehydro Misoprostol, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.

Structural formula: {0} (CAS {1})

Methyl 7-[2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopenten-1-yl]heptanoate (CAS 1331639-92-9) is a chemical compound with the molecular formula C22H36O4 and a molecular weight of 364.5 g/mol. IUPAC name: methyl 7-[2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopenten-1-yl]heptanoate. InChIKey: HHBZJXGYROTGEG-ZHACJKMWSA-N.

Identity
Molecular formulaC22H36O4
Molecular weight364.5 g/mol
IUPAC namemethyl 7-[2-[(E)-4-hydroxy-4-methyloct-1-enyl]-5-oxocyclopenten-1-yl]heptanoate
InChIKeyHHBZJXGYROTGEG-ZHACJKMWSA-N
SMILESCCCCC(C)(C/C=C/C1=C(C(=O)CC1)CCCCCCC(=O)OC)O

Computed by PubChem (NCBI)