Products 88931-51-5
CAS 88931-51-5 is the registry number for Clinprost. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate (CAS 88931-51-5) is a chemical compound with the molecular formula C22H36O4 and a molecular weight of 364.5 g/mol. IUPAC name: methyl 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate. InChIKey: QIGRQPVOWVHYBT-KABTVRTISA-N.
| Molecular formula | C22H36O4 |
|---|---|
| Molecular weight | 364.5 g/mol |
| IUPAC name | methyl 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate |
| InChIKey | QIGRQPVOWVHYBT-KABTVRTISA-N |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@@H](C[C@H]2[C@@H]1CC(=C2)CCCCC(=O)OC)O)O |
Computed by PubChem (NCBI)
Synonyms:
Clinprost, Isocarbacyclin methyl ester, Arteron, clinprostum, Clinprost [INN], Tei 9090, Arteon, Ttc 909, Lipocurren, Lipo PGI2