CAS 853998-93-3 is the registry number for 11-Deoxy Limaprost. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 25mg, 1mg.
(E)-7-[(1R,2R)-2-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-5-oxocyclopentyl]hept-2-enoic acid (CAS 853998-93-3) is a chemical compound with the molecular formula C22H36O4 and a molecular weight of 364.5 g/mol. IUPAC name: (E)-7-[(1R,2R)-2-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-5-oxocyclopentyl]hept-2-enoic acid. InChIKey: GGXXRJAROSMGDC-NHEPTSSCSA-N.
| Molecular formula | C22H36O4 |
|---|---|
| Molecular weight | 364.5 g/mol |
| IUPAC name | (E)-7-[(1R,2R)-2-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-5-oxocyclopentyl]hept-2-enoic acid |
| InChIKey | GGXXRJAROSMGDC-NHEPTSSCSA-N |
| SMILES | CCCC[C@H](C)C[C@@H](/C=C/[C@H]1CCC(=O)[C@@H]1CCCC/C=C/C(=O)O)O |
Computed by PubChem (NCBI)