CAS 1331665-54-3 appears in our catalog under these names: Nor Doxepin-d3 Hydrochloride, >95% (HPLC), Nordoxepin D3 hydrochloride, Nordoxepin-d3 HCl, Nor doxepin-d3 hydrochloride, Nordoxepin-d3 (hydrochloride), 99.92%. Offered by: TRC, GLPBio, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 5 mg, 1 mg, 10 mg.
(3E)-3-(6H-benzo[c][1]benzoxepin-11-ylidene)-N-(trideuteriomethyl)propan-1-amine;hydrochloride (CAS 1331665-54-3) is a chemical compound with the molecular formula C18H20ClNO and a molecular weight of 304.8 g/mol. IUPAC name: (3E)-3-(6H-benzo[c][1]benzoxepin-11-ylidene)-N-(trideuteriomethyl)propan-1-amine;hydrochloride. InChIKey: GNPPEZGJRSOKRE-KJVDRLPBSA-N.
| Molecular formula | C18H20ClNO |
|---|---|
| Molecular weight | 304.8 g/mol |
| IUPAC name | (3E)-3-(6H-benzo[c][1]benzoxepin-11-ylidene)-N-(trideuteriomethyl)propan-1-amine;hydrochloride |
| InChIKey | GNPPEZGJRSOKRE-KJVDRLPBSA-N |
| SMILES | [2H]C([2H])([2H])NCC/C=C/1\C2=CC=CC=C2COC3=CC=CC=C31.Cl |
Computed by PubChem (NCBI)