CAS 27590-61-0 appears in our catalog under these names: α–Pyrrolidino–2–phenylacetophenone (hydrochloride), α-Pyrrolidino-2-phenylacetophenone (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg.
1,2-diphenyl-2-pyrrolidin-1-ylethanone;hydrochloride (CAS 27590-61-0) is a chemical compound with the molecular formula C18H20ClNO and a molecular weight of 301.8 g/mol. IUPAC name: 1,2-diphenyl-2-pyrrolidin-1-ylethanone;hydrochloride. InChIKey: DZBGHEJUNJIOIJ-UHFFFAOYSA-N.
| Molecular formula | C18H20ClNO |
|---|---|
| Molecular weight | 301.8 g/mol |
| IUPAC name | 1,2-diphenyl-2-pyrrolidin-1-ylethanone;hydrochloride |
| InChIKey | DZBGHEJUNJIOIJ-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(C2=CC=CC=C2)C(=O)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)