Products 2249819-14-3
CAS 2249819-14-3 appears in our catalog under these names: Nordoxepin-d4 Hydrochloride, Nordoxepin–d4 hydrochloride, Nordoxepin-d4 (hydrochloride), 99.90%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 25mg, 1mg, 10 mg, 1 mg, 5 mg.
(3E)-3-(6H-benzo[c][1]benzoxepin-11-ylidene)-1,1,2,2-tetradeuterio-N-methylpropan-1-amine;hydrochloride (CAS 2249819-14-3) is a chemical compound with the molecular formula C18H20ClNO and a molecular weight of 305.8 g/mol. IUPAC name: (3E)-3-(6H-benzo[c][1]benzoxepin-11-ylidene)-1,1,2,2-tetradeuterio-N-methylpropan-1-amine;hydrochloride. InChIKey: GNPPEZGJRSOKRE-UBZAMMCJSA-N.
| Molecular formula | C18H20ClNO |
|---|---|
| Molecular weight | 305.8 g/mol |
| IUPAC name | (3E)-3-(6H-benzo[c][1]benzoxepin-11-ylidene)-1,1,2,2-tetradeuterio-N-methylpropan-1-amine;hydrochloride |
| InChIKey | GNPPEZGJRSOKRE-UBZAMMCJSA-N |
| SMILES | [2H]C([2H])(/C=C/1\C2=CC=CC=C2COC3=CC=CC=C31)C([2H])([2H])NC.Cl |
Computed by PubChem (NCBI)