Products 1331825-41-2

CAS 1331825-41-2 is the registry number for Valsartan Impurity 48. Offered by: Chemat Brand. Available pack sizes: on request.

3-methyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]butanoic acid (CAS 1331825-41-2) is a chemical compound with the molecular formula C19H21N5O2 and a molecular weight of 351.4 g/mol. IUPAC name: 3-methyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]butanoic acid. InChIKey: NSXSCTCKWRSTHJ-UHFFFAOYSA-N.

Identity
Molecular formulaC19H21N5O2
Molecular weight351.4 g/mol
IUPAC name3-methyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]butanoic acid
InChIKeyNSXSCTCKWRSTHJ-UHFFFAOYSA-N
SMILESCC(C)C(C(=O)O)NCC1=CC=C(C=C1)C2=CC=CC=C2C3=NNN=N3

Computed by PubChem (NCBI)