CAS 676129-92-3 appears in our catalog under these names: Valsartan Impurity 10, Valsartan Desvaleryl Impurity, Des(oxopentyl) Valsartan, >95% (HPLC), (2S)-3-Methyl-2-(((2'-(1H-tetrazol-5-yl)biphenyl-4-yl)methyl)amino)butanoic Acid (Despentanoylvalsartan), Devaleryl Valsartan Impurity. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, TargetMol. Available pack sizes: on request, 250mg, 25mg, 10mg, 5mg, 10mM (in 1ml dmso), 50mg, 100mg.
(2S)-3-methyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]butanoic acid (CAS 676129-92-3) is a chemical compound with the molecular formula C19H21N5O2 and a molecular weight of 351.4 g/mol. IUPAC name: (2S)-3-methyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]butanoic acid. InChIKey: NSXSCTCKWRSTHJ-KRWDZBQOSA-N.
| Molecular formula | C19H21N5O2 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (2S)-3-methyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]butanoic acid |
| InChIKey | NSXSCTCKWRSTHJ-KRWDZBQOSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NCC1=CC=C(C=C1)C2=CC=CC=C2C3=NNN=N3 |
Computed by PubChem (NCBI)