CAS 151272-90-1 appears in our catalog under these names: CP 135807, CP-135807. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 50mg, 5mg, 25mg, 100mg, Get quote.
3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-N-(3-nitro-2-pyridinyl)-1H-indol-5-amine (CAS 151272-90-1) is a chemical compound with the molecular formula C19H21N5O2 and a molecular weight of 351.4 g/mol. IUPAC name: 3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-N-(3-nitro-2-pyridinyl)-1H-indol-5-amine. InChIKey: YPFIYPNOWVPAPR-OAHLLOKOSA-N.
| Molecular formula | C19H21N5O2 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 3-[[(2R)-1-methylpyrrolidin-2-yl]methyl]-N-(3-nitro-2-pyridinyl)-1H-indol-5-amine |
| InChIKey | YPFIYPNOWVPAPR-OAHLLOKOSA-N |
| SMILES | CN1CCC[C@@H]1CC2=CNC3=C2C=C(C=C3)NC4=C(C=CC=N4)[N+](=O)[O-] |
Computed by PubChem (NCBI)