CAS 1331889-36-1 appears in our catalog under these names: L-Norleucine-d9, >95% (HPLC), L-2-Aminohexanoic-3,3,4,4,5,5,6,6,6-d9 Acid, 99 atom % D, min 98% Chemical Purity, L-Norleucine-d9, 99.81%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 1mg, 0,01g, 0,005g, 1 mg.
(2S)-2-amino-3,3,4,4,5,5,6,6,6-nonadeuteriohexanoic acid (CAS 1331889-36-1) is a chemical compound with the molecular formula C6H13NO2 and a molecular weight of 140.23 g/mol. IUPAC name: (2S)-2-amino-3,3,4,4,5,5,6,6,6-nonadeuteriohexanoic acid. InChIKey: LRQKBLKVPFOOQJ-PLJAHZBCSA-N.
| Molecular formula | C6H13NO2 |
|---|---|
| Molecular weight | 140.23 g/mol |
| IUPAC name | (2S)-2-amino-3,3,4,4,5,5,6,6,6-nonadeuteriohexanoic acid |
| InChIKey | LRQKBLKVPFOOQJ-PLJAHZBCSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)