CAS 2243004-88-6 appears in our catalog under these names: DL-2-Aminohexanoic-3,3,4,4,5,5,6,6,6-d9 Acid, 98 atom % D, min 98% Chemical Purity, DL-2-Aminohexanoic acid-d9. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1 mg, 5 mg, 25 mg, 50 mg, 10 mg.
2-amino-3,3,4,4,5,5,6,6,6-nonadeuteriohexanoic acid (CAS 2243004-88-6) is a chemical compound with the molecular formula C6H13NO2 and a molecular weight of 140.23 g/mol. IUPAC name: 2-amino-3,3,4,4,5,5,6,6,6-nonadeuteriohexanoic acid. InChIKey: LRQKBLKVPFOOQJ-YNSOAAEFSA-N.
| Molecular formula | C6H13NO2 |
|---|---|
| Molecular weight | 140.23 g/mol |
| IUPAC name | 2-amino-3,3,4,4,5,5,6,6,6-nonadeuteriohexanoic acid |
| InChIKey | LRQKBLKVPFOOQJ-YNSOAAEFSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(C(=O)O)N |
Computed by PubChem (NCBI)