Products 2185812-01-3
CAS 2185812-01-3 appears in our catalog under these names: D-2-Aminohexanoic-3,3,4,4,5,5,6,6,6-d9 Acid, 99 atom % D, min 98% Chemical Purity, D-2-Aminohexanoic acid-d9. Offered by: CDN, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1mg, 5mg.
(2R)-2-amino-3,3,4,4,5,5,6,6,6-nonadeuteriohexanoic acid (CAS 2185812-01-3) is a chemical compound with the molecular formula C6H13NO2 and a molecular weight of 140.23 g/mol. IUPAC name: (2R)-2-amino-3,3,4,4,5,5,6,6,6-nonadeuteriohexanoic acid. InChIKey: LRQKBLKVPFOOQJ-CJPSRAQNSA-N.
| Molecular formula | C6H13NO2 |
|---|---|
| Molecular weight | 140.23 g/mol |
| IUPAC name | (2R)-2-amino-3,3,4,4,5,5,6,6,6-nonadeuteriohexanoic acid |
| InChIKey | LRQKBLKVPFOOQJ-CJPSRAQNSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[C@H](C(=O)O)N |
Computed by PubChem (NCBI)