CAS 1332355-13-1 is the registry number for (3,4-Difluorophenyl)(3-(methylsulfanyl)phenyl)methanone. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(3,4-difluorophenyl)-(3-methylsulfanylphenyl)methanone (CAS 1332355-13-1) is a chemical compound with the molecular formula C14H10F2OS and a molecular weight of 264.29 g/mol. IUPAC name: (3,4-difluorophenyl)-(3-methylsulfanylphenyl)methanone. InChIKey: HGVQDQGTXQKHMT-UHFFFAOYSA-N.
| Molecular formula | C14H10F2OS |
|---|---|
| Molecular weight | 264.29 g/mol |
| IUPAC name | (3,4-difluorophenyl)-(3-methylsulfanylphenyl)methanone |
| InChIKey | HGVQDQGTXQKHMT-UHFFFAOYSA-N |
| SMILES | CSC1=CC=CC(=C1)C(=O)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)