CAS 2496644-37-0 is the registry number for Baloxavir Marboxil Impurity 45. Offered by: Chemat Brand. Available pack sizes: on request.
8,9-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-ol (CAS 2496644-37-0) is a chemical compound with the molecular formula C14H10F2OS and a molecular weight of 264.29 g/mol. IUPAC name: 8,9-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-ol. InChIKey: BXCARLHQDRXHIK-UHFFFAOYSA-N.
| Molecular formula | C14H10F2OS |
|---|---|
| Molecular weight | 264.29 g/mol |
| IUPAC name | 8,9-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-ol |
| InChIKey | BXCARLHQDRXHIK-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C=C2C(C3=CC=CC=C3S1)O)F)F |
Computed by PubChem (NCBI)