CAS 1820028-78-1 is the registry number for 7-Ethoxy-4,6-difluoro-dibenzothiophen-100g. Offered by: Chemat Brand. Available pack sizes: 100g.
3-ethoxy-4,6-difluorodibenzothiophene (CAS 1820028-78-1) is a chemical compound with the molecular formula C14H10F2OS and a molecular weight of 264.29 g/mol. IUPAC name: 3-ethoxy-4,6-difluorodibenzothiophene. InChIKey: MMHOENQDGWCBNZ-UHFFFAOYSA-N.
| Molecular formula | C14H10F2OS |
|---|---|
| Molecular weight | 264.29 g/mol |
| IUPAC name | 3-ethoxy-4,6-difluorodibenzothiophene |
| InChIKey | MMHOENQDGWCBNZ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C2=C(C=C1)C3=C(S2)C(=CC=C3)F)F |
Computed by PubChem (NCBI)