CAS 1332531-65-3 is the registry number for 1-(1-Adamantyl)-1,2,3,6-tetrahydropyridine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(1-adamantyl)-3,6-dihydro-2H-pyridine;hydrochloride (CAS 1332531-65-3) is a chemical compound with the molecular formula C15H24ClN and a molecular weight of 253.81 g/mol. IUPAC name: 1-(1-adamantyl)-3,6-dihydro-2H-pyridine;hydrochloride. InChIKey: CIMHACSNXYSWHD-UHFFFAOYSA-N.
| Molecular formula | C15H24ClN |
|---|---|
| Molecular weight | 253.81 g/mol |
| IUPAC name | 1-(1-adamantyl)-3,6-dihydro-2H-pyridine;hydrochloride |
| InChIKey | CIMHACSNXYSWHD-UHFFFAOYSA-N |
| SMILES | C1CN(CC=C1)C23CC4CC(C2)CC(C4)C3.Cl |
Computed by PubChem (NCBI)