CAS 1391530-27-0 appears in our catalog under these names: (4-Aminophenyl)(azetidin-1-yl)methanone, 98%, 98%, (R)-2-(4-(Tert-butyl)phenyl)piperidine hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-(4-tert-butylphenyl)piperidine;hydrochloride (CAS 1391530-27-0) is a chemical compound with the molecular formula C15H24ClN and a molecular weight of 253.81 g/mol. IUPAC name: (2R)-2-(4-tert-butylphenyl)piperidine;hydrochloride. InChIKey: UKHFDALZDUHOCB-PFEQFJNWSA-N.
| Molecular formula | C15H24ClN |
|---|---|
| Molecular weight | 253.81 g/mol |
| IUPAC name | (2R)-2-(4-tert-butylphenyl)piperidine;hydrochloride |
| InChIKey | UKHFDALZDUHOCB-PFEQFJNWSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)[C@H]2CCCCN2.Cl |
Computed by PubChem (NCBI)