CAS 14350-43-7 appears in our catalog under these names: Benzenemethanaminium, 4-ethenyl-N,N,N-triethyl-, chloride, 95-<97%, Benzenemethanaminium, 4-ethenyl-N,N,N-triethyl-, chloride, ≥97-<99%, N,N-Diethyl-N-(4-vinylbenzyl)ethanaminium chloride, 97%+(HPLC),RG, 97%+(HPLC),RG. Offered by: Hoffman Fine Chemicals, Chemat. Available pack sizes: 50g, 100g, 200g, 300g, 400g, 500g, 250mg, 1g.
(4-ethenylphenyl)methyl-triethylazanium chloride (CAS 14350-43-7) is a chemical compound with the molecular formula C15H24ClN and a molecular weight of 253.81 g/mol. IUPAC name: (4-ethenylphenyl)methyl-triethylazanium chloride. InChIKey: RSGSRVZMECOJNA-UHFFFAOYSA-M.
| Molecular formula | C15H24ClN |
|---|---|
| Molecular weight | 253.81 g/mol |
| IUPAC name | (4-ethenylphenyl)methyl-triethylazanium chloride |
| InChIKey | RSGSRVZMECOJNA-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CC)CC1=CC=C(C=C1)C=C.[Cl-] |
Computed by PubChem (NCBI)