CAS 1332581-63-1 appears in our catalog under these names: 6-Bromo-imidazo[1,2-a]pyridine-8-carboxylic acid methyl ester hydrochloride, 95%, Methyl 6-bromoimidazo(1,2-a)pyridine-8-carboxylate hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
Methyl 6-bromoimidazo[1,2-a]pyridine-8-carboxylate;hydrochloride (CAS 1332581-63-1) is a chemical compound with the molecular formula C9H8BrClN2O2 and a molecular weight of 291.53 g/mol. IUPAC name: methyl 6-bromoimidazo[1,2-a]pyridine-8-carboxylate;hydrochloride. InChIKey: QHMXZLGCLUOULJ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClN2O2 |
|---|---|
| Molecular weight | 291.53 g/mol |
| IUPAC name | methyl 6-bromoimidazo[1,2-a]pyridine-8-carboxylate;hydrochloride |
| InChIKey | QHMXZLGCLUOULJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CN2C1=NC=C2)Br.Cl |
Computed by PubChem (NCBI)