CAS 568557-44-8 is the registry number for 2-Bromo-n'-(2-chloroacetyl)benzohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 250mg, 5g.
2-bromo-N'-(2-chloroacetyl)benzohydrazide (CAS 568557-44-8) is a chemical compound with the molecular formula C9H8BrClN2O2 and a molecular weight of 291.53 g/mol. IUPAC name: 2-bromo-N'-(2-chloroacetyl)benzohydrazide. InChIKey: ZEGXFGAMLSBYFS-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClN2O2 |
|---|---|
| Molecular weight | 291.53 g/mol |
| IUPAC name | 2-bromo-N'-(2-chloroacetyl)benzohydrazide |
| InChIKey | ZEGXFGAMLSBYFS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NNC(=O)CCl)Br |
Computed by PubChem (NCBI)