CAS 1420800-33-4 is the registry number for 7-Bromo-1-methyl-1,3-benzodiazole-5-carboxylic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
7-bromo-1-methylbenzimidazole-5-carboxylic acid;hydrochloride (CAS 1420800-33-4) is a chemical compound with the molecular formula C9H8BrClN2O2 and a molecular weight of 291.53 g/mol. IUPAC name: 7-bromo-1-methylbenzimidazole-5-carboxylic acid;hydrochloride. InChIKey: GIICMIHDHIZYFG-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClN2O2 |
|---|---|
| Molecular weight | 291.53 g/mol |
| IUPAC name | 7-bromo-1-methylbenzimidazole-5-carboxylic acid;hydrochloride |
| InChIKey | GIICMIHDHIZYFG-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C1C(=CC(=C2)C(=O)O)Br.Cl |
Computed by PubChem (NCBI)