Products 1420800-33-4

CAS 1420800-33-4 is the registry number for 7-Bromo-1-methyl-1,3-benzodiazole-5-carboxylic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

7-bromo-1-methylbenzimidazole-5-carboxylic acid;hydrochloride (CAS 1420800-33-4) is a chemical compound with the molecular formula C9H8BrClN2O2 and a molecular weight of 291.53 g/mol. IUPAC name: 7-bromo-1-methylbenzimidazole-5-carboxylic acid;hydrochloride. InChIKey: GIICMIHDHIZYFG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8BrClN2O2
Molecular weight291.53 g/mol
IUPAC name7-bromo-1-methylbenzimidazole-5-carboxylic acid;hydrochloride
InChIKeyGIICMIHDHIZYFG-UHFFFAOYSA-N
SMILESCN1C=NC2=C1C(=CC(=C2)C(=O)O)Br.Cl

Computed by PubChem (NCBI)