CAS 1332584-37-8 is the registry number for 2-(Dichloromethyl)-6-methylimidazo[1,2-a]pyridine hydrochloride, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-(dichloromethyl)-6-methylimidazo[1,2-a]pyridine;hydrochloride (CAS 1332584-37-8) is a chemical compound with the molecular formula C9H9Cl3N2 and a molecular weight of 251.5 g/mol. IUPAC name: 2-(dichloromethyl)-6-methylimidazo[1,2-a]pyridine;hydrochloride. InChIKey: WXPCUIVLPILKJT-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl3N2 |
|---|---|
| Molecular weight | 251.5 g/mol |
| IUPAC name | 2-(dichloromethyl)-6-methylimidazo[1,2-a]pyridine;hydrochloride |
| InChIKey | WXPCUIVLPILKJT-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(N=C2C=C1)C(Cl)Cl.Cl |
Computed by PubChem (NCBI)