CAS 1443423-11-7 is the registry number for 6-Chloro-2-(2-chloroethyl)-1h-benzimidazole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
6-chloro-2-(2-chloroethyl)-1H-benzimidazole;hydrochloride (CAS 1443423-11-7) is a chemical compound with the molecular formula C9H9Cl3N2 and a molecular weight of 251.5 g/mol. IUPAC name: 6-chloro-2-(2-chloroethyl)-1H-benzimidazole;hydrochloride. InChIKey: VQBXRLZXORCZNO-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl3N2 |
|---|---|
| Molecular weight | 251.5 g/mol |
| IUPAC name | 6-chloro-2-(2-chloroethyl)-1H-benzimidazole;hydrochloride |
| InChIKey | VQBXRLZXORCZNO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC(=N2)CCCl.Cl |
Computed by PubChem (NCBI)