Products 6022-33-9

CAS 6022-33-9 appears in our catalog under these names: CPMF/Du Pont Herbicide 685, CPMF. Offered by: TRC, HPC Standards. Available pack sizes: 250mg, 1x25mg.

Structural formula: {0} (CAS {1})

N'-(3,4-dichlorophenyl)-N,N-dimethylcarbamimidoyl chloride (CAS 6022-33-9) is a chemical compound with the molecular formula C9H9Cl3N2 and a molecular weight of 251.5 g/mol. IUPAC name: N'-(3,4-dichlorophenyl)-N,N-dimethylcarbamimidoyl chloride. InChIKey: WKQYAIDXQNGNIQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9Cl3N2
Molecular weight251.5 g/mol
IUPAC nameN'-(3,4-dichlorophenyl)-N,N-dimethylcarbamimidoyl chloride
InChIKeyWKQYAIDXQNGNIQ-UHFFFAOYSA-N
SMILESCN(C)C(=NC1=CC(=C(C=C1)Cl)Cl)Cl

Computed by PubChem (NCBI)