CAS 6022-33-9 appears in our catalog under these names: CPMF/Du Pont Herbicide 685, CPMF. Offered by: TRC, HPC Standards. Available pack sizes: 250mg, 1x25mg.
N'-(3,4-dichlorophenyl)-N,N-dimethylcarbamimidoyl chloride (CAS 6022-33-9) is a chemical compound with the molecular formula C9H9Cl3N2 and a molecular weight of 251.5 g/mol. IUPAC name: N'-(3,4-dichlorophenyl)-N,N-dimethylcarbamimidoyl chloride. InChIKey: WKQYAIDXQNGNIQ-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl3N2 |
|---|---|
| Molecular weight | 251.5 g/mol |
| IUPAC name | N'-(3,4-dichlorophenyl)-N,N-dimethylcarbamimidoyl chloride |
| InChIKey | WKQYAIDXQNGNIQ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=NC1=CC(=C(C=C1)Cl)Cl)Cl |
Computed by PubChem (NCBI)