CAS 1332650-85-7 appears in our catalog under these names: 2-[(tert-butoxy)methyl]-5-fluorophenylboronic acid, 95%, 2–(Tert–butoxyMethyl)–5–fluorophenylboronic acid, (2-(tert-Butoxymethyl)-5-fluorophenyl)boronic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 100mg, 5g, 1g, 250mg.
[5-fluoro-2-[(2-methylpropan-2-yl)oxymethyl]phenyl]boronic acid (CAS 1332650-85-7) is a chemical compound with the molecular formula C11H16BFO3 and a molecular weight of 226.05 g/mol. IUPAC name: [5-fluoro-2-[(2-methylpropan-2-yl)oxymethyl]phenyl]boronic acid. InChIKey: LHQNRNXARAPRIX-UHFFFAOYSA-N.
| Molecular formula | C11H16BFO3 |
|---|---|
| Molecular weight | 226.05 g/mol |
| IUPAC name | [5-fluoro-2-[(2-methylpropan-2-yl)oxymethyl]phenyl]boronic acid |
| InChIKey | LHQNRNXARAPRIX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)COC(C)(C)C)(O)O |
Computed by PubChem (NCBI)