Products 13327-14-5
CAS 13327-14-5 appears in our catalog under these names: Prilocaine EP Impurity F HCl, N-Phenyl-2-(propylamino)propanamide hydrochloride, 95%, Prilocaine Impurity 6（Prilocaine EP Impurity F）. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N-phenyl-2-(propylamino)propanamide;hydrochloride (CAS 13327-14-5) is a chemical compound with the molecular formula C12H19ClN2O and a molecular weight of 242.74 g/mol. IUPAC name: N-phenyl-2-(propylamino)propanamide;hydrochloride. InChIKey: YHIIDAZPZNUNGF-UHFFFAOYSA-N.
| Molecular formula | C12H19ClN2O |
|---|---|
| Molecular weight | 242.74 g/mol |
| IUPAC name | N-phenyl-2-(propylamino)propanamide;hydrochloride |
| InChIKey | YHIIDAZPZNUNGF-UHFFFAOYSA-N |
| SMILES | CCCNC(C)C(=O)NC1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)