Products 133276-80-9
CAS 133276-80-9 is the registry number for Samixogrel. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-6-[4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]phenyl]-6-pyridin-3-ylhex-5-enoic acid (CAS 133276-80-9) is a chemical compound with the molecular formula C25H25ClN2O4S and a molecular weight of 485.0 g/mol. IUPAC name: (E)-6-[4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]phenyl]-6-pyridin-3-ylhex-5-enoic acid. InChIKey: LGHLGTHRJNIRCA-ZXKDJJQISA-N.
| Molecular formula | C25H25ClN2O4S |
|---|---|
| Molecular weight | 485.0 g/mol |
| IUPAC name | (E)-6-[4-[2-[(4-chlorophenyl)sulfonylamino]ethyl]phenyl]-6-pyridin-3-ylhex-5-enoic acid |
| InChIKey | LGHLGTHRJNIRCA-ZXKDJJQISA-N |
| SMILES | C1=CC(=CN=C1)/C(=C/CCCC(=O)O)/C2=CC=C(C=C2)CCNS(=O)(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)