CAS 1332832-15-1 appears in our catalog under these names: (S)–1–(2–Methoxyphenyl)ethanamine hydrochloride, (S)-1-(2-Methoxyphenyl)ethanamine hydrochloride, 95%, (S)-1-(2-Methoxyphenyl)ethanamine hydrochloride, 98%, (S)-1-(2-Methoxyphenyl)ethanamine hydrochloride, 95%, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg.
(1S)-1-(2-methoxyphenyl)ethanamine;hydrochloride (CAS 1332832-15-1) is a chemical compound with the molecular formula C9H14ClNO and a molecular weight of 187.66 g/mol. IUPAC name: (1S)-1-(2-methoxyphenyl)ethanamine;hydrochloride. InChIKey: NTKNCZHNEDRTEP-FJXQXJEOSA-N.
| Molecular formula | C9H14ClNO |
|---|---|
| Molecular weight | 187.66 g/mol |
| IUPAC name | (1S)-1-(2-methoxyphenyl)ethanamine;hydrochloride |
| InChIKey | NTKNCZHNEDRTEP-FJXQXJEOSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1OC)N.Cl |
Computed by PubChem (NCBI)