Products 1332966-02-5
CAS 1332966-02-5 appears in our catalog under these names: Mono-(7-carboxy-4-methylheptyl) Phthalate-d4, >95% (HPLC), Mono-(7-carboxy-4-methylheptyl) phthalate-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 0,5mg, 5mg, 500 μg.
2-(7-carboxy-4-methylheptoxy)carbonyl-3,4,5,6-tetradeuteriobenzoic acid (CAS 1332966-02-5) is a chemical compound with the molecular formula C17H22O6 and a molecular weight of 326.38 g/mol. IUPAC name: 2-(7-carboxy-4-methylheptoxy)carbonyl-3,4,5,6-tetradeuteriobenzoic acid. InChIKey: IGGGGTKTEAEHSG-HZYQYMQTSA-N.
| Molecular formula | C17H22O6 |
|---|---|
| Molecular weight | 326.38 g/mol |
| IUPAC name | 2-(7-carboxy-4-methylheptoxy)carbonyl-3,4,5,6-tetradeuteriobenzoic acid |
| InChIKey | IGGGGTKTEAEHSG-HZYQYMQTSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCCCC(C)CCCC(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)