Products 61137-09-5

CAS 61137-09-5 is the registry number for 1,2,4-Benzenetricarboxylic Acid 1-(2-ethylhexyl) Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.

Structural formula: {0} (CAS {1})

4-(2-ethylhexoxycarbonyl)benzene-1,3-dicarboxylic acid (CAS 61137-09-5) is a chemical compound with the molecular formula C17H22O6 and a molecular weight of 322.4 g/mol. IUPAC name: 4-(2-ethylhexoxycarbonyl)benzene-1,3-dicarboxylic acid. InChIKey: BPAVWKYYIPGEQX-UHFFFAOYSA-N.

Identity
Molecular formulaC17H22O6
Molecular weight322.4 g/mol
IUPAC name4-(2-ethylhexoxycarbonyl)benzene-1,3-dicarboxylic acid
InChIKeyBPAVWKYYIPGEQX-UHFFFAOYSA-N
SMILESCCCCC(CC)COC(=O)C1=C(C=C(C=C1)C(=O)O)C(=O)O

Computed by PubChem (NCBI)